C26H38N4O3 — CID 87635085
2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(2-anilino-2-hydroxyethyl)piperidin-4-yl]-N-ethylacetamide (PubChem CID 87635085) has the molecular formula C26H38N4O3 and a molecular weight of 454.62 g/mol. Its IUPAC name is 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(2-anilino-2-hydroxyethyl)piperidin-4-yl]-N-ethylacetamide.
| Compound Name | 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(2-anilino-2-hydroxyethyl)piperidin-4-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 87635085 |
| Molecular Formula | C26H38N4O3 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 2-(4-amino-2,3,5-trimethylphenoxy)-N-[1-(2-anilino-2-hydroxyethyl)piperidin-4-yl]-N-ethylacetamide |
| SMILES | CCN(C(=O)COc1cc(C)c(N)c(C)c1C)C1CCN(CC(O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C26H38N4O3/c1-5-30(25(32)17-33-23-15-18(2)26(27)20(4)19(23)3)22-11-13-29(14-12-22)16-24(31)28-21-9-7-6-8-10-21/h6-10,15,22,24,28,31H,5,11-14,16-17,27H2,1-4H3 |
| InChIKey | TVVRIDOVBVOGDE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|