C13H22O5Ti — CID 87635155
3,3-di(propan-2-yloxy)heptane-2,4,6-trione;titanium (PubChem CID 87635155) has the molecular formula C13H22O5Ti and a molecular weight of 306.18 g/mol. Its IUPAC name is 3,3-di(propan-2-yloxy)heptane-2,4,6-trione;titanium.
| Compound Name | 3,3-di(propan-2-yloxy)heptane-2,4,6-trione;titanium |
|---|---|
| PubChem CID | 87635155 |
| Molecular Formula | C13H22O5Ti |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3,3-di(propan-2-yloxy)heptane-2,4,6-trione;titanium |
| SMILES | CC(=O)CC(=O)C(OC(C)C)(OC(C)C)C(C)=O.[Ti] |
| InChI | InChI=1S/C13H22O5.Ti/c1-8(2)17-13(11(6)15,18-9(3)4)12(16)7-10(5)14;/h8-9H,7H2,1-6H3; |
| InChIKey | XFZNAOGGGKCLSJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|