About 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole
3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole (PubChem CID 87635188) has the molecular formula C8H4F6N2O2
and a molecular weight of 274.12 g/mol. Its IUPAC name is 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole |
| PubChem CID | 87635188 |
| Molecular Formula | C8H4F6N2O2 |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole |
| SMILES | FC(F)(F)c1ccon1.FC(F)(F)c1cnoc1 |
| InChI | InChI=1S/2C4H2F3NO/c5-4(6,7)3-1-8-9-2-3;5-4(6,7)3-1-2-9-8-3/h2*1-2H |
| InChIKey | UHLOUFNAVDDEPO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole?
The IUPAC name of 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole (CID 87635188) is 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole.
What is the SMILES notation for 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole?
The canonical SMILES for 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole is FC(F)(F)c1ccon1.FC(F)(F)c1cnoc1.
What is the InChIKey of 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole?
The InChIKey is UHLOUFNAVDDEPO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H2F3NO/c5-4(6,7)3-1-8-9-2-3;5-4(6,7)3-1-2-9-8-3/h2*1-2H.
What are the key properties of 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole?
3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole has a molecular weight of 274.12 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)-1,2-oxazole;4-(trifluoromethyl)-1,2-oxazole is sourced from PubChem (CID 87635188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).