C27H28F2NO+ — CID 87635239
[1-[(2,4-difluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol (PubChem CID 87635239) has the molecular formula C27H28F2NO+ and a molecular weight of 420.52 g/mol. Its IUPAC name is [1-[(2,4-difluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol.
| Compound Name | [1-[(2,4-difluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 87635239 |
| Molecular Formula | C27H28F2NO+ |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | [1-[(2,4-difluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)C12CC[N+](Cc3ccc(F)cc3F)(CC1)CC2 |
| InChI | InChI=1S/C27H28F2NO/c28-24-12-11-21(25(29)19-24)20-30-16-13-26(14-17-30,15-18-30)27(31,22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-12,19,31H,13-18,20H2/q+1 |
| InChIKey | QXXDNRRHQITEBM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|