C15H19BrN2O3S — CID 8763584
2-(4-bromophenoxy)-N'-(2-cyclopentylsulfanylacetyl)acetohydrazide (PubChem CID 8763584) has the molecular formula C15H19BrN2O3S and a molecular weight of 387.30 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N'-(2-cyclopentylsulfanylacetyl)acetohydrazide.
| Compound Name | 2-(4-bromophenoxy)-N'-(2-cyclopentylsulfanylacetyl)acetohydrazide |
|---|---|
| PubChem CID | 8763584 |
| Molecular Formula | C15H19BrN2O3S |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 2-(4-bromophenoxy)-N'-(2-cyclopentylsulfanylacetyl)acetohydrazide |
| SMILES | O=C(COc1ccc(Br)cc1)NNC(=O)CSC1CCCC1 |
| InChI | InChI=1S/C15H19BrN2O3S/c16-11-5-7-12(8-6-11)21-9-14(19)17-18-15(20)10-22-13-3-1-2-4-13/h5-8,13H,1-4,9-10H2,(H,17,19)(H,18,20) |
| InChIKey | JJXYADNAOWJNSP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|