C15H16ClN3O2 — CID 87636088
(E)-N-hydroxy-3-[6-(4-methylanilino)-3-pyridinyl]prop-2-enamide;hydrochloride (PubChem CID 87636088) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.77 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[6-(4-methylanilino)-3-pyridinyl]prop-2-enamide;hydrochloride.
| Compound Name | (E)-N-hydroxy-3-[6-(4-methylanilino)-3-pyridinyl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 87636088 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (E)-N-hydroxy-3-[6-(4-methylanilino)-3-pyridinyl]prop-2-enamide;hydrochloride |
| SMILES | Cc1ccc(Nc2ccc(/C=C/C(=O)NO)cn2)cc1.Cl |
| InChI | InChI=1S/C15H15N3O2.ClH/c1-11-2-6-13(7-3-11)17-14-8-4-12(10-16-14)5-9-15(19)18-20;/h2-10,20H,1H3,(H,16,17)(H,18,19);1H/b9-5+; |
| InChIKey | RPYYBEXTCWVJMI-SZKNIZGXSA-N |
| XLogP | 3.07 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|