C22H24ClN3O3 — CID 87637094
(E)-3-[5-chloro-6-[[(1S,2R)-2-phenylcyclopropyl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 87637094) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is (E)-3-[5-chloro-6-[[(1S,2R)-2-phenylcyclopropyl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[5-chloro-6-[[(1S,2R)-2-phenylcyclopropyl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 87637094 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (E)-3-[5-chloro-6-[[(1S,2R)-2-phenylcyclopropyl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(/C=C/c1cnc(N[C@H]2C[C@@H]2c2ccccc2)c(Cl)c1)NOC1CCCCO1 |
| InChI | InChI=1S/C22H24ClN3O3/c23-18-12-15(9-10-20(27)26-29-21-8-4-5-11-28-21)14-24-22(18)25-19-13-17(19)16-6-2-1-3-7-16/h1-3,6-7,9-10,12,14,17,19,21H,4-5,8,11,13H2,(H,24,25)(H,26,27)/b10-9+/t17-,19+,21?/m1/s1 |
| InChIKey | DRVCXNDCPAAXJB-RGUYTFHCSA-N |
| XLogP | 4.29 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|