About [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol
[6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol (PubChem CID 87637216) has the molecular formula C6H9NS3
and a molecular weight of 191.35 g/mol. Its IUPAC name is [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol.
Molecular Properties
| Compound Name | [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol |
| PubChem CID | 87637216 |
| Molecular Formula | C6H9NS3 |
| Molecular Weight | 191.35 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol |
| SMILES | SCC1=CN=C(CS)CS1 |
| InChI | InChI=1S/C6H9NS3/c8-2-5-4-10-6(3-9)1-7-5/h1,8-9H,2-4H2 |
| InChIKey | YRNTYAJTDNOOOE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol?
The IUPAC name of [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol (CID 87637216) is [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol.
What is the SMILES notation for [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol?
The canonical SMILES for [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol is SCC1=CN=C(CS)CS1.
What is the InChIKey of [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol?
The InChIKey is YRNTYAJTDNOOOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NS3/c8-2-5-4-10-6(3-9)1-7-5/h1,8-9H,2-4H2.
What are the key properties of [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol?
[6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol has a molecular weight of 191.35 g/mol, XLogP of 1.88, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(sulfanylmethyl)-2H-1,4-thiazin-3-yl]methanethiol is sourced from PubChem (CID 87637216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).