C20H27Cl2N5O2 — CID 87637691
(E)-N-hydroxy-3-[4-methyl-2-[[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]amino]pyrimidin-5-yl]prop-2-enamide;dihydrochloride (PubChem CID 87637691) has the molecular formula C20H27Cl2N5O2 and a molecular weight of 440.38 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-methyl-2-[[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]amino]pyrimidin-5-yl]prop-2-enamide;dihydrochloride.
| Compound Name | (E)-N-hydroxy-3-[4-methyl-2-[[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]amino]pyrimidin-5-yl]prop-2-enamide;dihydrochloride |
|---|---|
| PubChem CID | 87637691 |
| Molecular Formula | C20H27Cl2N5O2 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | (E)-N-hydroxy-3-[4-methyl-2-[[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]amino]pyrimidin-5-yl]prop-2-enamide;dihydrochloride |
| SMILES | Cc1ccc(CN2CC[C@@H](Nc3ncc(/C=C/C(=O)NO)c(C)n3)C2)cc1.Cl.Cl |
| InChI | InChI=1S/C20H25N5O2.2ClH/c1-14-3-5-16(6-4-14)12-25-10-9-18(13-25)23-20-21-11-17(15(2)22-20)7-8-19(26)24-27;;/h3-8,11,18,27H,9-10,12-13H2,1-2H3,(H,24,26)(H,21,22,23);2*1H/b8-7+;;/t18-;;/m1../s1 |
| InChIKey | DQCYEHLSVLPDDN-LIPPBIOKSA-N |
| XLogP | 3.14 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|