C11H19F3N4O4S — CID 87637916
2,2,2-trifluoro-N-[2-[(1-methylsulfonylpiperidin-4-yl)carbamoylamino]ethyl]acetamide (PubChem CID 87637916) has the molecular formula C11H19F3N4O4S and a molecular weight of 360.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[(1-methylsulfonylpiperidin-4-yl)carbamoylamino]ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[(1-methylsulfonylpiperidin-4-yl)carbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 87637916 |
| Molecular Formula | C11H19F3N4O4S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[(1-methylsulfonylpiperidin-4-yl)carbamoylamino]ethyl]acetamide |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)NCCNC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H19F3N4O4S/c1-23(21,22)18-6-2-8(3-7-18)17-10(20)16-5-4-15-9(19)11(12,13)14/h8H,2-7H2,1H3,(H,15,19)(H2,16,17,20) |
| InChIKey | SICGYDYFDGALOP-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|