C17H8F7NO4 — CID 87638038
2-[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]-4,5-dimethoxyisoindole-1,3-dione (PubChem CID 87638038) has the molecular formula C17H8F7NO4 and a molecular weight of 423.24 g/mol. Its IUPAC name is 2-[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]-4,5-dimethoxyisoindole-1,3-dione.
| Compound Name | 2-[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]-4,5-dimethoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 87638038 |
| Molecular Formula | C17H8F7NO4 |
| Molecular Weight | 423.24 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 2-[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]-4,5-dimethoxyisoindole-1,3-dione |
| SMILES | COc1ccc2c(c1OC)C(=O)N(C(F)(F)c1c(F)c(F)c(F)c(F)c1F)C2=O |
| InChI | InChI=1S/C17H8F7NO4/c1-28-6-4-3-5-7(14(6)29-2)16(27)25(15(5)26)17(23,24)8-9(18)11(20)13(22)12(21)10(8)19/h3-4H,1-2H3 |
| InChIKey | USKWHOHRBIZSDX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|