C21H37N5O3 — CID 87638197
3-cyclopentyl-N-[3-[5-[(dimethylamino)methyl]-1H-imidazol-2-yl]-2,2-dimethylpropyl]-4-[formyl(hydroxy)amino]butanamide (PubChem CID 87638197) has the molecular formula C21H37N5O3 and a molecular weight of 407.56 g/mol. Its IUPAC name is 3-cyclopentyl-N-[3-[5-[(dimethylamino)methyl]-1H-imidazol-2-yl]-2,2-dimethylpropyl]-4-[formyl(hydroxy)amino]butanamide.
| Compound Name | 3-cyclopentyl-N-[3-[5-[(dimethylamino)methyl]-1H-imidazol-2-yl]-2,2-dimethylpropyl]-4-[formyl(hydroxy)amino]butanamide |
|---|---|
| PubChem CID | 87638197 |
| Molecular Formula | C21H37N5O3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 3-cyclopentyl-N-[3-[5-[(dimethylamino)methyl]-1H-imidazol-2-yl]-2,2-dimethylpropyl]-4-[formyl(hydroxy)amino]butanamide |
| SMILES | CN(C)Cc1cnc(CC(C)(C)CNC(=O)CC(CN(O)C=O)C2CCCC2)[nH]1 |
| InChI | InChI=1S/C21H37N5O3/c1-21(2,10-19-22-11-18(24-19)13-25(3)4)14-23-20(28)9-17(12-26(29)15-27)16-7-5-6-8-16/h11,15-17,29H,5-10,12-14H2,1-4H3,(H,22,24)(H,23,28) |
| InChIKey | COUKXYUHHANKEL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|