About 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine
3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine (PubChem CID 87638391) has the molecular formula C6H14Cl2N4
and a molecular weight of 213.11 g/mol. Its IUPAC name is 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine.
Molecular Properties
| Compound Name | 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine |
| PubChem CID | 87638391 |
| Molecular Formula | C6H14Cl2N4 |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine |
| SMILES | CC(N)C/N=N/CC(N)C(Cl)Cl |
| InChI | InChI=1S/C6H14Cl2N4/c1-4(9)2-11-12-3-5(10)6(7)8/h4-6H,2-3,9-10H2,1H3/b12-11+ |
| InChIKey | ITWTXQRISFJSKP-VAWYXSNFSA-N |
| XLogP | 0.92 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine?
The IUPAC name of 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine (CID 87638391) is 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine.
What is the SMILES notation for 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine?
The canonical SMILES for 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine is CC(N)C/N=N/CC(N)C(Cl)Cl.
What is the InChIKey of 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine?
The InChIKey is ITWTXQRISFJSKP-VAWYXSNFSA-N. The full InChI is InChI=1S/C6H14Cl2N4/c1-4(9)2-11-12-3-5(10)6(7)8/h4-6H,2-3,9-10H2,1H3/b12-11+.
What are the key properties of 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine?
3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine has a molecular weight of 213.11 g/mol, XLogP of 0.92, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminopropyldiazenyl)-1,1-dichloropropan-2-amine is sourced from PubChem (CID 87638391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).