About 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride
1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride (PubChem CID 87639032) has the molecular formula C6H4ClF3N2O
and a molecular weight of 212.56 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride.
Molecular Properties
| Compound Name | 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride |
| PubChem CID | 87639032 |
| Molecular Formula | C6H4ClF3N2O |
| Molecular Weight | 212.56 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride |
| SMILES | O=C(Cl)c1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C6H4ClF3N2O/c7-5(13)4-1-11-12(2-4)3-6(8,9)10/h1-2H,3H2 |
| InChIKey | YMTASZPNDJAOKN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride?
The IUPAC name of 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride (CID 87639032) is 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride.
What is the SMILES notation for 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride?
The canonical SMILES for 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride is O=C(Cl)c1cnn(CC(F)(F)F)c1.
What is the InChIKey of 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride?
The InChIKey is YMTASZPNDJAOKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClF3N2O/c7-5(13)4-1-11-12(2-4)3-6(8,9)10/h1-2H,3H2.
What are the key properties of 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride?
1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride has a molecular weight of 212.56 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl chloride is sourced from PubChem (CID 87639032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).