About 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea
1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea (PubChem CID 87639171) has the molecular formula C17H25N5O3S
and a molecular weight of 379.49 g/mol. Its IUPAC name is 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea.
Molecular Properties
| Compound Name | 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea |
| PubChem CID | 87639171 |
| Molecular Formula | C17H25N5O3S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea |
| SMILES | CCC(CC)NC(=O)N(N)c1ccc(Oc2cnc(N)s2)c(COC)c1 |
| InChI | InChI=1S/C17H25N5O3S/c1-4-12(5-2)21-17(23)22(19)13-6-7-14(11(8-13)10-24-3)25-15-9-20-16(18)26-15/h6-9,12H,4-5,10,19H2,1-3H3,(H2,18,20)(H,21,23) |
| InChIKey | COQIYPLYDJAAEQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea?
The IUPAC name of 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea (CID 87639171) is 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea.
What is the SMILES notation for 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea?
The canonical SMILES for 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea is CCC(CC)NC(=O)N(N)c1ccc(Oc2cnc(N)s2)c(COC)c1.
What is the InChIKey of 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea?
The InChIKey is COQIYPLYDJAAEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5O3S/c1-4-12(5-2)21-17(23)22(19)13-6-7-14(11(8-13)10-24-3)25-15-9-20-16(18)26-15/h6-9,12H,4-5,10,19H2,1-3H3,(H2,18,20)(H,21,23).
What are the key properties of 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea?
1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea has a molecular weight of 379.49 g/mol, XLogP of 3.24, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1-[4-[(2-amino-1,3-thiazol-5-yl)oxy]-3-(methoxymethyl)phenyl]-3-pentan-3-ylurea is sourced from PubChem (CID 87639171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).