C17H20N2O5S — CID 87639192
(2S,3R)-N,3-dihydroxy-2-[(4-phenylphenyl)sulfonylmethylamino]butanamide (PubChem CID 87639192) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is (2S,3R)-N,3-dihydroxy-2-[(4-phenylphenyl)sulfonylmethylamino]butanamide.
| Compound Name | (2S,3R)-N,3-dihydroxy-2-[(4-phenylphenyl)sulfonylmethylamino]butanamide |
|---|---|
| PubChem CID | 87639192 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2S,3R)-N,3-dihydroxy-2-[(4-phenylphenyl)sulfonylmethylamino]butanamide |
| SMILES | C[C@@H](O)[C@H](NCS(=O)(=O)c1ccc(-c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C17H20N2O5S/c1-12(20)16(17(21)19-22)18-11-25(23,24)15-9-7-14(8-10-15)13-5-3-2-4-6-13/h2-10,12,16,18,20,22H,11H2,1H3,(H,19,21)/t12-,16+/m1/s1 |
| InChIKey | SGBFNBOOBXSGQS-WBMJQRKESA-N |
| XLogP | 0.93 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|