C12H14O6 — CID 87639240
[4-(1,2-dihydroxyethyl)-3,5-dioxohepta-1,6-dien-4-yl] prop-2-enoate (PubChem CID 87639240) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is [4-(1,2-dihydroxyethyl)-3,5-dioxohepta-1,6-dien-4-yl] prop-2-enoate.
| Compound Name | [4-(1,2-dihydroxyethyl)-3,5-dioxohepta-1,6-dien-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 87639240 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | [4-(1,2-dihydroxyethyl)-3,5-dioxohepta-1,6-dien-4-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C(=O)C=C)(C(=O)C=C)C(O)CO |
| InChI | InChI=1S/C12H14O6/c1-4-8(14)12(9(15)5-2,10(16)7-13)18-11(17)6-3/h4-6,10,13,16H,1-3,7H2 |
| InChIKey | GWFLDICHNAZIRT-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|