C25H39N5O3 — CID 87639285
(2R)-2-(cyclopentylmethyl)-N-[(1S)-1-[6-[(dimethylamino)methyl]-1H-benzimidazol-2-yl]-2,2-dimethylpropyl]-3-[formyl(hydroxy)amino]propanamide (PubChem CID 87639285) has the molecular formula C25H39N5O3 and a molecular weight of 457.62 g/mol. Its IUPAC name is (2R)-2-(cyclopentylmethyl)-N-[(1S)-1-[6-[(dimethylamino)methyl]-1H-benzimidazol-2-yl]-2,2-dimethylpropyl]-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | (2R)-2-(cyclopentylmethyl)-N-[(1S)-1-[6-[(dimethylamino)methyl]-1H-benzimidazol-2-yl]-2,2-dimethylpropyl]-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 87639285 |
| Molecular Formula | C25H39N5O3 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | (2R)-2-(cyclopentylmethyl)-N-[(1S)-1-[6-[(dimethylamino)methyl]-1H-benzimidazol-2-yl]-2,2-dimethylpropyl]-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CN(C)Cc1ccc2nc([C@@H](NC(=O)[C@H](CC3CCCC3)CN(O)C=O)C(C)(C)C)[nH]c2c1 |
| InChI | InChI=1S/C25H39N5O3/c1-25(2,3)22(23-26-20-11-10-18(14-29(4)5)13-21(20)27-23)28-24(32)19(15-30(33)16-31)12-17-8-6-7-9-17/h10-11,13,16-17,19,22,33H,6-9,12,14-15H2,1-5H3,(H,26,27)(H,28,32)/t19-,22-/m1/s1 |
| InChIKey | CXIWBYCPCPOJIN-DENIHFKCSA-N |
| XLogP | 3.87 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|