C26H41N5O3 — CID 87639470
3-cyclopentyl-N-[3-[6-[(dimethylamino)methyl]-1-methylbenzimidazol-2-yl]-2,2-dimethylpropyl]-4-[formyl(hydroxy)amino]butanamide (PubChem CID 87639470) has the molecular formula C26H41N5O3 and a molecular weight of 471.65 g/mol. Its IUPAC name is 3-cyclopentyl-N-[3-[6-[(dimethylamino)methyl]-1-methylbenzimidazol-2-yl]-2,2-dimethylpropyl]-4-[formyl(hydroxy)amino]butanamide.
| Compound Name | 3-cyclopentyl-N-[3-[6-[(dimethylamino)methyl]-1-methylbenzimidazol-2-yl]-2,2-dimethylpropyl]-4-[formyl(hydroxy)amino]butanamide |
|---|---|
| PubChem CID | 87639470 |
| Molecular Formula | C26H41N5O3 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | 3-cyclopentyl-N-[3-[6-[(dimethylamino)methyl]-1-methylbenzimidazol-2-yl]-2,2-dimethylpropyl]-4-[formyl(hydroxy)amino]butanamide |
| SMILES | CN(C)Cc1ccc2nc(CC(C)(C)CNC(=O)CC(CN(O)C=O)C3CCCC3)n(C)c2c1 |
| InChI | InChI=1S/C26H41N5O3/c1-26(2,14-24-28-22-11-10-19(15-29(3)4)12-23(22)30(24)5)17-27-25(33)13-21(16-31(34)18-32)20-8-6-7-9-20/h10-12,18,20-21,34H,6-9,13-17H2,1-5H3,(H,27,33) |
| InChIKey | BSTNXMMFZGQZDO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|