About bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride
bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride (PubChem CID 87639988) has the molecular formula C17H14ClN3
and a molecular weight of 295.77 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride |
| PubChem CID | 87639988 |
| Molecular Formula | C17H14ClN3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride |
| SMILES | C#Cc1ccccc1-c1cnc(N)[nH]1.Cl.c1cc2ccc1-2 |
| InChI | InChI=1S/C11H9N3.C6H4.ClH/c1-2-8-5-3-4-6-9(8)10-7-13-11(12)14-10;1-2-6-4-3-5(1)6;/h1,3-7H,(H3,12,13,14);1-4H;1H |
| InChIKey | NGUSAKJLJIPBHD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride?
The IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride (CID 87639988) is bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride?
The canonical SMILES for bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride is C#Cc1ccccc1-c1cnc(N)[nH]1.Cl.c1cc2ccc1-2.
What is the InChIKey of bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride?
The InChIKey is NGUSAKJLJIPBHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3.C6H4.ClH/c1-2-8-5-3-4-6-9(8)10-7-13-11(12)14-10;1-2-6-4-3-5(1)6;/h1,3-7H,(H3,12,13,14);1-4H;1H.
What are the key properties of bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride?
bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride has a molecular weight of 295.77 g/mol, XLogP of 3.73, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,3,5-triene;5-(2-ethynylphenyl)-1H-imidazol-2-amine;hydrochloride is sourced from PubChem (CID 87639988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).