About N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide
N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide (PubChem CID 876401) has the molecular formula C15H16N2O4
and a molecular weight of 288.30 g/mol. Its IUPAC name is N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide.
Molecular Properties
| Compound Name | N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide |
| PubChem CID | 876401 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)c2ccco2)c(C)c1 |
| InChI | InChI=1S/C15H16N2O4/c1-10-5-6-12(11(2)8-10)21-9-14(18)16-17-15(19)13-4-3-7-20-13/h3-8H,9H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | XCRRQKQXDXLWID-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide?
The IUPAC name of N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide (CID 876401) is N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide.
What is the SMILES notation for N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide?
The canonical SMILES for N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide is Cc1ccc(OCC(=O)NNC(=O)c2ccco2)c(C)c1.
What is the InChIKey of N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide?
The InChIKey is XCRRQKQXDXLWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O4/c1-10-5-6-12(11(2)8-10)21-9-14(18)16-17-15(19)13-4-3-7-20-13/h3-8H,9H2,1-2H3,(H,16,18)(H,17,19).
What are the key properties of N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide?
N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide has a molecular weight of 288.30 g/mol, XLogP of 1.74, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2,4-dimethylphenoxy)acetyl]furan-2-carbohydrazide is sourced from PubChem (CID 876401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).