About 2,3-dimethylpent-2-ene;hydrazine
2,3-dimethylpent-2-ene;hydrazine (PubChem CID 87640391) has the molecular formula C7H18N2
and a molecular weight of 130.23 g/mol. Its IUPAC name is 2,3-dimethylpent-2-ene;hydrazine.
Molecular Properties
| Compound Name | 2,3-dimethylpent-2-ene;hydrazine |
| PubChem CID | 87640391 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | 2,3-dimethylpent-2-ene;hydrazine |
| SMILES | CCC(C)=C(C)C.NN |
| InChI | InChI=1S/C7H14.H4N2/c1-5-7(4)6(2)3;1-2/h5H2,1-4H3;1-2H2 |
| InChIKey | HOFQJCXJGKFKGX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylpent-2-ene;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylpent-2-ene;hydrazine?
The IUPAC name of 2,3-dimethylpent-2-ene;hydrazine (CID 87640391) is 2,3-dimethylpent-2-ene;hydrazine.
What is the SMILES notation for 2,3-dimethylpent-2-ene;hydrazine?
The canonical SMILES for 2,3-dimethylpent-2-ene;hydrazine is CCC(C)=C(C)C.NN.
What is the InChIKey of 2,3-dimethylpent-2-ene;hydrazine?
The InChIKey is HOFQJCXJGKFKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.H4N2/c1-5-7(4)6(2)3;1-2/h5H2,1-4H3;1-2H2.
What are the key properties of 2,3-dimethylpent-2-ene;hydrazine?
2,3-dimethylpent-2-ene;hydrazine has a molecular weight of 130.23 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylpent-2-ene;hydrazine is sourced from PubChem (CID 87640391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).