C28H28FN3O2 — CID 87640410
8-(1,2-dihydroacenaphthylen-1-yl)-1-(4-fluorophenyl)-3-[[(2R)-oxiran-2-yl]methyl]-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 87640410) has the molecular formula C28H28FN3O2 and a molecular weight of 457.55 g/mol. Its IUPAC name is 8-(1,2-dihydroacenaphthylen-1-yl)-1-(4-fluorophenyl)-3-[[(2R)-oxiran-2-yl]methyl]-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-(1,2-dihydroacenaphthylen-1-yl)-1-(4-fluorophenyl)-3-[[(2R)-oxiran-2-yl]methyl]-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 87640410 |
| Molecular Formula | C28H28FN3O2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 8-(1,2-dihydroacenaphthylen-1-yl)-1-(4-fluorophenyl)-3-[[(2R)-oxiran-2-yl]methyl]-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C1N(C[C@@H]2CO2)CN(c2ccc(F)cc2)C12CCN(C1Cc3cccc4cccc1c34)CC2 |
| InChI | InChI=1S/C28H28FN3O2/c29-21-7-9-22(10-8-21)32-18-31(16-23-17-34-23)27(33)28(32)11-13-30(14-12-28)25-15-20-5-1-3-19-4-2-6-24(25)26(19)20/h1-10,23,25H,11-18H2/t23-,25?/m1/s1 |
| InChIKey | KIUVSSROVDZTSC-XQZUBTRRSA-N |
| XLogP | 4.12 |
| TPSA | 39.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|