C25H24Cl2F2N2OS — CID 87640510
5-(2,4-dichlorophenyl)-N-(4,4-difluorocyclohexyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbothioamide (PubChem CID 87640510) has the molecular formula C25H24Cl2F2N2OS and a molecular weight of 509.45 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-N-(4,4-difluorocyclohexyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbothioamide.
| Compound Name | 5-(2,4-dichlorophenyl)-N-(4,4-difluorocyclohexyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbothioamide |
|---|---|
| PubChem CID | 87640510 |
| Molecular Formula | C25H24Cl2F2N2OS |
| Molecular Weight | 509.45 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-N-(4,4-difluorocyclohexyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbothioamide |
| SMILES | COc1ccc(-n2c(-c3ccc(Cl)cc3Cl)cc(C(=S)NC3CCC(F)(F)CC3)c2C)cc1 |
| InChI | InChI=1S/C25H24Cl2F2N2OS/c1-15-21(24(33)30-17-9-11-25(28,29)12-10-17)14-23(20-8-3-16(26)13-22(20)27)31(15)18-4-6-19(32-2)7-5-18/h3-8,13-14,17H,9-12H2,1-2H3,(H,30,33) |
| InChIKey | JQHUNDAJSBEPNH-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.45 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|