C7H9F5N2O3 — CID 87640608
(2S)-2-hydroxy-2-methyl-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide (PubChem CID 87640608) has the molecular formula C7H9F5N2O3 and a molecular weight of 264.15 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-methyl-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide.
| Compound Name | (2S)-2-hydroxy-2-methyl-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
|---|---|
| PubChem CID | 87640608 |
| Molecular Formula | C7H9F5N2O3 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (2S)-2-hydroxy-2-methyl-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
| SMILES | C[C@](O)(C(N)=O)C(=O)NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H9F5N2O3/c1-5(17,3(13)15)4(16)14-2-6(8,9)7(10,11)12/h17H,2H2,1H3,(H2,13,15)(H,14,16)/t5-/m0/s1 |
| InChIKey | HAABJOKSGQUMKN-YFKPBYRVSA-N |
| XLogP | -0.46 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|