About [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene
[(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene (PubChem CID 87640920) has the molecular formula C28H23FO4S2
and a molecular weight of 506.62 g/mol. Its IUPAC name is [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene.
Molecular Properties
| Compound Name | [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene |
| PubChem CID | 87640920 |
| Molecular Formula | C28H23FO4S2 |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)(C(/C=C/c1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H23FO4S2/c29-28(34(30,31)25-17-9-3-10-18-25,35(32,33)26-19-11-4-12-20-26)27(24-15-7-2-8-16-24)22-21-23-13-5-1-6-14-23/h1-22,27H/b22-21+ |
| InChIKey | RAIPGNPEEVDMSP-QURGRASLSA-N |
| XLogP | 6.05 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene?
The IUPAC name of [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene (CID 87640920) is [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene.
What is the SMILES notation for [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene?
The canonical SMILES for [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene is O=S(=O)(c1ccccc1)C(F)(C(/C=C/c1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene?
The InChIKey is RAIPGNPEEVDMSP-QURGRASLSA-N. The full InChI is InChI=1S/C28H23FO4S2/c29-28(34(30,31)25-17-9-3-10-18-25,35(32,33)26-19-11-4-12-20-26)27(24-15-7-2-8-16-24)22-21-23-13-5-1-6-14-23/h1-22,27H/b22-21+.
What are the key properties of [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene?
[(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene has a molecular weight of 506.62 g/mol, XLogP of 6.05, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4,4-bis(benzenesulfonyl)-4-fluoro-3-phenylbut-1-enyl]benzene is sourced from PubChem (CID 87640920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).