About bis(2-phosphonatobenzenesulfonic acid);zirconium(4+)
bis(2-phosphonatobenzenesulfonic acid);zirconium(4+) (PubChem CID 87640999) has the molecular formula C12H10O12P2S2Zr
and a molecular weight of 563.51 g/mol. Its IUPAC name is bis(2-phosphonatobenzenesulfonic acid);zirconium(4+).
Molecular Properties
| Compound Name | bis(2-phosphonatobenzenesulfonic acid);zirconium(4+) |
| PubChem CID | 87640999 |
| Molecular Formula | C12H10O12P2S2Zr |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 561.81 |
| IUPAC Name | bis(2-phosphonatobenzenesulfonic acid);zirconium(4+) |
| SMILES | O=P([O-])([O-])c1ccccc1S(=O)(=O)O.O=P([O-])([O-])c1ccccc1S(=O)(=O)O.[Zr+4] |
| InChI | InChI=1S/2C6H7O6PS.Zr/c2*7-13(8,9)5-3-1-2-4-6(5)14(10,11)12;/h2*1-4H,(H2,7,8,9)(H,10,11,12);/q;;+4/p-4 |
| InChIKey | OEIFNMUHFNFCLX-UHFFFAOYSA-J |
| XLogP | -3.06 |
| TPSA | 235.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-phosphonatobenzenesulfonic acid);zirconium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-phosphonatobenzenesulfonic acid);zirconium(4+)?
The IUPAC name of bis(2-phosphonatobenzenesulfonic acid);zirconium(4+) (CID 87640999) is bis(2-phosphonatobenzenesulfonic acid);zirconium(4+).
What is the SMILES notation for bis(2-phosphonatobenzenesulfonic acid);zirconium(4+)?
The canonical SMILES for bis(2-phosphonatobenzenesulfonic acid);zirconium(4+) is O=P([O-])([O-])c1ccccc1S(=O)(=O)O.O=P([O-])([O-])c1ccccc1S(=O)(=O)O.[Zr+4].
What is the InChIKey of bis(2-phosphonatobenzenesulfonic acid);zirconium(4+)?
The InChIKey is OEIFNMUHFNFCLX-UHFFFAOYSA-J. The full InChI is InChI=1S/2C6H7O6PS.Zr/c2*7-13(8,9)5-3-1-2-4-6(5)14(10,11)12;/h2*1-4H,(H2,7,8,9)(H,10,11,12);/q;;+4/p-4.
What are the key properties of bis(2-phosphonatobenzenesulfonic acid);zirconium(4+)?
bis(2-phosphonatobenzenesulfonic acid);zirconium(4+) has a molecular weight of 563.51 g/mol, XLogP of -3.06, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-phosphonatobenzenesulfonic acid);zirconium(4+) is sourced from PubChem (CID 87640999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).