About diethylazanium;methanesulfonate
diethylazanium;methanesulfonate (PubChem CID 87641845) has the molecular formula C5H15NO3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is diethylazanium;methanesulfonate.
Molecular Properties
| Compound Name | diethylazanium;methanesulfonate |
| PubChem CID | 87641845 |
| Molecular Formula | C5H15NO3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.08 |
| IUPAC Name | diethylazanium;methanesulfonate |
| SMILES | CC[NH2+]CC.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C4H11N.CH4O3S/c1-3-5-4-2;1-5(2,3)4/h5H,3-4H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | HMJCTELBDUTXPQ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze diethylazanium;methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylazanium;methanesulfonate?
The IUPAC name of diethylazanium;methanesulfonate (CID 87641845) is diethylazanium;methanesulfonate.
What is the SMILES notation for diethylazanium;methanesulfonate?
The canonical SMILES for diethylazanium;methanesulfonate is CC[NH2+]CC.CS(=O)(=O)[O-].
What is the InChIKey of diethylazanium;methanesulfonate?
The InChIKey is HMJCTELBDUTXPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.CH4O3S/c1-3-5-4-2;1-5(2,3)4/h5H,3-4H2,1-2H3;1H3,(H,2,3,4).
What are the key properties of diethylazanium;methanesulfonate?
diethylazanium;methanesulfonate has a molecular weight of 169.25 g/mol, XLogP of -1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethylazanium;methanesulfonate is sourced from PubChem (CID 87641845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).