About 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid
2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid (PubChem CID 87641952) has the molecular formula C15H11Cl2F3N2O4S
and a molecular weight of 443.23 g/mol. Its IUPAC name is 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid.
Molecular Properties
| Compound Name | 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid |
| PubChem CID | 87641952 |
| Molecular Formula | C15H11Cl2F3N2O4S |
| Molecular Weight | 443.23 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid |
| SMILES | NC(=O)c1ccc(Cl)cc1Cl.O=S(=O)(O)/C=C/c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C8H6F3NO3S.C7H5Cl2NO/c9-8(10,11)7-2-1-6(5-12-7)3-4-16(13,14)15;8-4-1-2-5(7(10)11)6(9)3-4/h1-5H,(H,13,14,15);1-3H,(H2,10,11)/b4-3+; |
| InChIKey | BEEUSRZWUILRIM-BJILWQEISA-N |
| XLogP | 4.05 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid?
The IUPAC name of 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid (CID 87641952) is 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid.
What is the SMILES notation for 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid?
The canonical SMILES for 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid is NC(=O)c1ccc(Cl)cc1Cl.O=S(=O)(O)/C=C/c1ccc(C(F)(F)F)nc1.
What is the InChIKey of 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid?
The InChIKey is BEEUSRZWUILRIM-BJILWQEISA-N. The full InChI is InChI=1S/C8H6F3NO3S.C7H5Cl2NO/c9-8(10,11)7-2-1-6(5-12-7)3-4-16(13,14)15;8-4-1-2-5(7(10)11)6(9)3-4/h1-5H,(H,13,14,15);1-3H,(H2,10,11)/b4-3+;.
What are the key properties of 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid?
2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid has a molecular weight of 443.23 g/mol, XLogP of 4.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichlorobenzamide;(E)-2-[6-(trifluoromethyl)-3-pyridinyl]ethenesulfonic acid is sourced from PubChem (CID 87641952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).