C54H68O13 — CID 87642232
1-O-[7-acetyloxy-2-(3,4-diacetyloxyphenyl)-4-oxochromen-5-yl] 4-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] butanedioate (PubChem CID 87642232) has the molecular formula C54H68O13 and a molecular weight of 925.12 g/mol. Its IUPAC name is 1-O-[7-acetyloxy-2-(3,4-diacetyloxyphenyl)-4-oxochromen-5-yl] 4-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] butanedioate.
| Compound Name | 1-O-[7-acetyloxy-2-(3,4-diacetyloxyphenyl)-4-oxochromen-5-yl] 4-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] butanedioate |
|---|---|
| PubChem CID | 87642232 |
| Molecular Formula | C54H68O13 |
| Molecular Weight | 925.12 g/mol |
| Exact Mass | 924.47 |
| IUPAC Name | 1-O-[7-acetyloxy-2-(3,4-diacetyloxyphenyl)-4-oxochromen-5-yl] 4-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] butanedioate |
| SMILES | CC(=O)Oc1cc(OC(=O)CCC(=O)Oc2c(C)c(C)c3c(c2C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O3)c2c(=O)cc(-c3ccc(OC(C)=O)c(OC(C)=O)c3)oc2c1 |
| InChI | InChI=1S/C54H68O13/c1-31(2)15-12-16-32(3)17-13-18-33(4)19-14-25-54(11)26-24-42-36(7)52(34(5)35(6)53(42)67-54)66-50(60)23-22-49(59)65-48-29-41(61-37(8)55)28-47-51(48)43(58)30-45(64-47)40-20-21-44(62-38(9)56)46(27-40)63-39(10)57/h20-21,27-33H,12-19,22-26H2,1-11H3 |
| InChIKey | CCYHGOGQQOMSLI-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 170.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.12 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|