About 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid
2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid (PubChem CID 87642281) has the molecular formula C15H11F6NO4S2
and a molecular weight of 447.38 g/mol. Its IUPAC name is 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid.
Molecular Properties
| Compound Name | 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid |
| PubChem CID | 87642281 |
| Molecular Formula | C15H11F6NO4S2 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid |
| SMILES | NC(=O)c1ccc(C(F)(F)F)cc1C(F)(F)F.O=S(=O)(O)/C=C/c1cccs1 |
| InChI | InChI=1S/C9H5F6NO.C6H6O3S2/c10-8(11,12)4-1-2-5(7(16)17)6(3-4)9(13,14)15;7-11(8,9)5-3-6-2-1-4-10-6/h1-3H,(H2,16,17);1-5H,(H,7,8,9)/b;5-3+ |
| InChIKey | IAKVIBDFCFXLLP-GWDXERMASA-N |
| XLogP | 4.43 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid?
The IUPAC name of 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid (CID 87642281) is 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid.
What is the SMILES notation for 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid?
The canonical SMILES for 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid is NC(=O)c1ccc(C(F)(F)F)cc1C(F)(F)F.O=S(=O)(O)/C=C/c1cccs1.
What is the InChIKey of 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid?
The InChIKey is IAKVIBDFCFXLLP-GWDXERMASA-N. The full InChI is InChI=1S/C9H5F6NO.C6H6O3S2/c10-8(11,12)4-1-2-5(7(16)17)6(3-4)9(13,14)15;7-11(8,9)5-3-6-2-1-4-10-6/h1-3H,(H2,16,17);1-5H,(H,7,8,9)/b;5-3+.
What are the key properties of 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid?
2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid has a molecular weight of 447.38 g/mol, XLogP of 4.43, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(trifluoromethyl)benzamide;(E)-2-thiophen-2-ylethenesulfonic acid is sourced from PubChem (CID 87642281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).