C18H30O9 — CID 87642585
3,7-dimethyloct-6-enyl formate;2-hydroxybutane-1,2,3-tricarboxylic acid (PubChem CID 87642585) has the molecular formula C18H30O9 and a molecular weight of 390.43 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl formate;2-hydroxybutane-1,2,3-tricarboxylic acid.
| Compound Name | 3,7-dimethyloct-6-enyl formate;2-hydroxybutane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87642585 |
| Molecular Formula | C18H30O9 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3,7-dimethyloct-6-enyl formate;2-hydroxybutane-1,2,3-tricarboxylic acid |
| SMILES | CC(C(=O)O)C(O)(CC(=O)O)C(=O)O.CC(C)=CCCC(C)CCOC=O |
| InChI | InChI=1S/C11H20O2.C7H10O7/c1-10(2)5-4-6-11(3)7-8-13-9-12;1-3(5(10)11)7(14,6(12)13)2-4(8)9/h5,9,11H,4,6-8H2,1-3H3;3,14H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | VAPNPUPIMWVAOR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|