C43H66N4O — CID 87642594
(6Z,9Z,12Z,15Z,26Z,29Z,32Z,35Z)-20,22-bis(diazomethyl)hentetraconta-6,9,12,15,26,29,32,35-octaen-21-one (PubChem CID 87642594) has the molecular formula C43H66N4O and a molecular weight of 655.03 g/mol. Its IUPAC name is (6Z,9Z,12Z,15Z,26Z,29Z,32Z,35Z)-20,22-bis(diazomethyl)hentetraconta-6,9,12,15,26,29,32,35-octaen-21-one.
| Compound Name | (6Z,9Z,12Z,15Z,26Z,29Z,32Z,35Z)-20,22-bis(diazomethyl)hentetraconta-6,9,12,15,26,29,32,35-octaen-21-one |
|---|---|
| PubChem CID | 87642594 |
| Molecular Formula | C43H66N4O |
| Molecular Weight | 655.03 g/mol |
| Exact Mass | 654.52 |
| IUPAC Name | (6Z,9Z,12Z,15Z,26Z,29Z,32Z,35Z)-20,22-bis(diazomethyl)hentetraconta-6,9,12,15,26,29,32,35-octaen-21-one |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(C=[N+]=[N-])C(=O)C(C=[N+]=[N-])CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H66N4O/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41(39-46-44)43(48)42(40-47-45)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,23-26,29-32,39-42H,3-10,15-16,21-22,27-28,33-38H2,1-2H3/b13-11-,14-12-,19-17-,20-18-,25-23-,26-24-,31-29-,32-30- |
| InChIKey | JREYWUASRGQECC-XCHUKFSYSA-N |
| XLogP | 12.68 |
| TPSA | 89.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.03 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|