About S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron
S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron (PubChem CID 87643178) has the molecular formula C22H20FeOS-6
and a molecular weight of 388.31 g/mol. Its IUPAC name is S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron.
Molecular Properties
| Compound Name | S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron |
| PubChem CID | 87643178 |
| Molecular Formula | C22H20FeOS-6 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron |
| SMILES | CC(=O)Sc1ccc(C#C[c-]2[cH-][cH-][cH-][cH-]2)cc1.CC[c-]1cccc1.[Fe] |
| InChI | InChI=1S/C15H11OS.C7H9.Fe/c1-12(16)17-15-10-8-14(9-11-15)7-6-13-4-2-3-5-13;1-2-7-5-3-4-6-7;/h2-5,8-11H,1H3;3-6H,2H2,1H3;/q-5;-1; |
| InChIKey | BXEHEFXWZXOXAQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron?
The IUPAC name of S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron (CID 87643178) is S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron.
What is the SMILES notation for S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron?
The canonical SMILES for S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron is CC(=O)Sc1ccc(C#C[c-]2[cH-][cH-][cH-][cH-]2)cc1.CC[c-]1cccc1.[Fe].
What is the InChIKey of S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron?
The InChIKey is BXEHEFXWZXOXAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11OS.C7H9.Fe/c1-12(16)17-15-10-8-14(9-11-15)7-6-13-4-2-3-5-13;1-2-7-5-3-4-6-7;/h2-5,8-11H,1H3;3-6H,2H2,1H3;/q-5;-1;.
What are the key properties of S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron?
S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron has a molecular weight of 388.31 g/mol, XLogP of 5.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-[4-(2-cyclopentylethynyl)phenyl] ethanethioate;5-ethylcyclopenta-1,3-diene;iron is sourced from PubChem (CID 87643178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).