About S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron
S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron (PubChem CID 87643237) has the molecular formula C18H16FeOS-6
and a molecular weight of 336.24 g/mol. Its IUPAC name is S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron.
Molecular Properties
| Compound Name | S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron |
| PubChem CID | 87643237 |
| Molecular Formula | C18H16FeOS-6 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron |
| SMILES | CC(=O)Sc1ccc(-[c-]2cccc2)cc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C13H11OS.C5H5.Fe/c1-10(14)15-13-8-6-12(7-9-13)11-4-2-3-5-11;1-2-4-5-3-1;/h2-9H,1H3;1-5H;/q-1;-5; |
| InChIKey | WYXPPHMEHJVKOF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron?
The IUPAC name of S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron (CID 87643237) is S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron.
What is the SMILES notation for S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron?
The canonical SMILES for S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron is CC(=O)Sc1ccc(-[c-]2cccc2)cc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron?
The InChIKey is WYXPPHMEHJVKOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11OS.C5H5.Fe/c1-10(14)15-13-8-6-12(7-9-13)11-4-2-3-5-11;1-2-4-5-3-1;/h2-9H,1H3;1-5H;/q-1;-5;.
What are the key properties of S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron?
S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron has a molecular weight of 336.24 g/mol, XLogP of 5.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-cyclopenta-2,4-dien-1-ylphenyl) ethanethioate;cyclopentane;iron is sourced from PubChem (CID 87643237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).