About S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron
S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron (PubChem CID 87643243) has the molecular formula C26H20FeOS-6
and a molecular weight of 436.36 g/mol. Its IUPAC name is S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron.
Molecular Properties
| Compound Name | S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron |
| PubChem CID | 87643243 |
| Molecular Formula | C26H20FeOS-6 |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron |
| SMILES | CC(=O)Sc1ccc(C#Cc2ccc(-[c-]3cccc3)cc2)cc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C21H15OS.C5H5.Fe/c1-16(22)23-21-14-10-18(11-15-21)7-6-17-8-12-20(13-9-17)19-4-2-3-5-19;1-2-4-5-3-1;/h2-5,8-15H,1H3;1-5H;/q-1;-5; |
| InChIKey | HDNRYHVLWHUXPV-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron?
The IUPAC name of S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron (CID 87643243) is S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron.
What is the SMILES notation for S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron?
The canonical SMILES for S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron is CC(=O)Sc1ccc(C#Cc2ccc(-[c-]3cccc3)cc2)cc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron?
The InChIKey is HDNRYHVLWHUXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15OS.C5H5.Fe/c1-16(22)23-21-14-10-18(11-15-21)7-6-17-8-12-20(13-9-17)19-4-2-3-5-19;1-2-4-5-3-1;/h2-5,8-15H,1H3;1-5H;/q-1;-5;.
What are the key properties of S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron?
S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron has a molecular weight of 436.36 g/mol, XLogP of 6.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;cyclopentane;iron is sourced from PubChem (CID 87643243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).