C21H31NO3 — CID 87643262
(6E)-6-hydroxyimino-7,7-dimethyl-3-(2-methylhexan-2-yl)-5a,8,9,9a-tetrahydrodibenzofuran-1-ol (PubChem CID 87643262) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is (6E)-6-hydroxyimino-7,7-dimethyl-3-(2-methylhexan-2-yl)-5a,8,9,9a-tetrahydrodibenzofuran-1-ol.
| Compound Name | (6E)-6-hydroxyimino-7,7-dimethyl-3-(2-methylhexan-2-yl)-5a,8,9,9a-tetrahydrodibenzofuran-1-ol |
|---|---|
| PubChem CID | 87643262 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | (6E)-6-hydroxyimino-7,7-dimethyl-3-(2-methylhexan-2-yl)-5a,8,9,9a-tetrahydrodibenzofuran-1-ol |
| SMILES | CCCCC(C)(C)c1cc(O)c2c(c1)OC1/C(=N/O)C(C)(C)CCC21 |
| InChI | InChI=1S/C21H31NO3/c1-6-7-9-20(2,3)13-11-15(23)17-14-8-10-21(4,5)19(22-24)18(14)25-16(17)12-13/h11-12,14,18,23-24H,6-10H2,1-5H3/b22-19- |
| InChIKey | XJUOEZCUSLDLLH-QOCHGBHMSA-N |
| XLogP | 5.35 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|