C63H52N4OS — CID 87643566
S-[4-[2-[4-[10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-5-yl]phenyl]ethynyl]phenyl] ethanethioate (PubChem CID 87643566) has the molecular formula C63H52N4OS and a molecular weight of 913.20 g/mol. Its IUPAC name is S-[4-[2-[4-[10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-5-yl]phenyl]ethynyl]phenyl] ethanethioate.
| Compound Name | S-[4-[2-[4-[10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-5-yl]phenyl]ethynyl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 87643566 |
| Molecular Formula | C63H52N4OS |
| Molecular Weight | 913.20 g/mol |
| Exact Mass | 912.39 |
| IUPAC Name | S-[4-[2-[4-[10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-5-yl]phenyl]ethynyl]phenyl] ethanethioate |
| SMILES | CC(=O)Sc1ccc(C#Cc2ccc(/C3=C4\C=CC(=N4)/C(c4c(C)cc(C)cc4C)=C4/C=CC(=N4)/C(c4c(C)cc(C)cc4C)=C4/C=CC(=N4)/C(c4c(C)cc(C)cc4C)=C4/C=CC3=N4)cc2)cc1 |
| InChI | InChI=1S/C63H52N4OS/c1-35-29-38(4)57(39(5)30-35)61-51-23-21-49(64-51)60(47-17-13-45(14-18-47)11-12-46-15-19-48(20-16-46)69-44(10)68)50-22-24-52(65-50)62(58-40(6)31-36(2)32-41(58)7)54-26-28-56(67-54)63(55-27-25-53(61)66-55)59-42(8)33-37(3)34-43(59)9/h13-34H,1-10H3/b60-49-,60-50-,61-51+,61-53+,62-52+,62-54+,63-55+,63-56+ |
| InChIKey | AIBWOBNSVCVTTL-JIQXYFTHSA-N |
| XLogP | 14.50 |
| TPSA | 66.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.20 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|