C15H9BrS — CID 87644038
7-bromo-11-thiatetracyclo[10.2.2.02,6.05,10]hexadeca-1(14),3,5(10),6,8,12,15-heptaene (PubChem CID 87644038) has the molecular formula C15H9BrS and a molecular weight of 301.21 g/mol. Its IUPAC name is 7-bromo-11-thiatetracyclo[10.2.2.02,6.05,10]hexadeca-1(14),3,5(10),6,8,12,15-heptaene.
| Compound Name | 7-bromo-11-thiatetracyclo[10.2.2.02,6.05,10]hexadeca-1(14),3,5(10),6,8,12,15-heptaene |
|---|---|
| PubChem CID | 87644038 |
| Molecular Formula | C15H9BrS |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 7-bromo-11-thiatetracyclo[10.2.2.02,6.05,10]hexadeca-1(14),3,5(10),6,8,12,15-heptaene |
| SMILES | Brc1ccc2c3c1C(C=C3)c1ccc(cc1)S2 |
| InChI | InChI=1S/C15H9BrS/c16-13-7-8-14-12-6-5-11(15(12)13)9-1-3-10(17-14)4-2-9/h1-8,11H |
| InChIKey | SZGOICUNKOWPQD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |