C34H59NO10Si3 — CID 87644079
prop-2-enyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(2-formyl-4-nitrophenoxy)oxane-2-carboxylate (PubChem CID 87644079) has the molecular formula C34H59NO10Si3 and a molecular weight of 726.10 g/mol. Its IUPAC name is prop-2-enyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(2-formyl-4-nitrophenoxy)oxane-2-carboxylate.
| Compound Name | prop-2-enyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(2-formyl-4-nitrophenoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 87644079 |
| Molecular Formula | C34H59NO10Si3 |
| Molecular Weight | 726.10 g/mol |
| Exact Mass | 725.34 |
| IUPAC Name | prop-2-enyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(2-formyl-4-nitrophenoxy)oxane-2-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1O[C@@H](Oc2ccc([N+](=O)[O-])cc2C=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H59NO10Si3/c1-17-20-40-30(37)28-26(43-46(11,12)32(2,3)4)27(44-47(13,14)33(5,6)7)29(45-48(15,16)34(8,9)10)31(42-28)41-25-19-18-24(35(38)39)21-23(25)22-36/h17-19,21-22,26-29,31H,1,20H2,2-16H3/t26-,27+,28+,29-,31-/m1/s1 |
| InChIKey | ZVRPHGOSTDJWMZ-UJPMWDSZSA-N |
| XLogP | 8.41 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.10 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|