C11H15F4NaO5S — CID 87644659
sodium 3-(cyclohexanecarbonyloxy)-1,1,2,2-tetrafluorobutane-1-sulfonate (PubChem CID 87644659) has the molecular formula C11H15F4NaO5S and a molecular weight of 358.29 g/mol. Its IUPAC name is sodium 3-(cyclohexanecarbonyloxy)-1,1,2,2-tetrafluorobutane-1-sulfonate.
| Compound Name | sodium 3-(cyclohexanecarbonyloxy)-1,1,2,2-tetrafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87644659 |
| Molecular Formula | C11H15F4NaO5S |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | sodium 3-(cyclohexanecarbonyloxy)-1,1,2,2-tetrafluorobutane-1-sulfonate |
| SMILES | CC(OC(=O)C1CCCCC1)C(F)(F)C(F)(F)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H16F4O5S.Na/c1-7(10(12,13)11(14,15)21(17,18)19)20-9(16)8-5-3-2-4-6-8;/h7-8H,2-6H2,1H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | FDIWEIMDVHSOAQ-UHFFFAOYSA-M |
| XLogP | -0.72 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|