About bromobenzene;iridium;pyridine
bromobenzene;iridium;pyridine (PubChem CID 87645537) has the molecular formula C11H9BrIrN-
and a molecular weight of 427.32 g/mol. Its IUPAC name is bromobenzene;iridium;pyridine.
Molecular Properties
| Compound Name | bromobenzene;iridium;pyridine |
| PubChem CID | 87645537 |
| Molecular Formula | C11H9BrIrN- |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 426.96 |
| IUPAC Name | bromobenzene;iridium;pyridine |
| SMILES | Brc1[c-]cccc1.[Ir].c1ccncc1 |
| InChI | InChI=1S/C6H4Br.C5H5N.Ir/c7-6-4-2-1-3-5-6;1-2-4-6-5-3-1;/h1-4H;1-5H;/q-1;; |
| InChIKey | LJUXUUCXWUJOGW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bromobenzene;iridium;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;iridium;pyridine?
The IUPAC name of bromobenzene;iridium;pyridine (CID 87645537) is bromobenzene;iridium;pyridine.
What is the SMILES notation for bromobenzene;iridium;pyridine?
The canonical SMILES for bromobenzene;iridium;pyridine is Brc1[c-]cccc1.[Ir].c1ccncc1.
What is the InChIKey of bromobenzene;iridium;pyridine?
The InChIKey is LJUXUUCXWUJOGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Br.C5H5N.Ir/c7-6-4-2-1-3-5-6;1-2-4-6-5-3-1;/h1-4H;1-5H;/q-1;;.
What are the key properties of bromobenzene;iridium;pyridine?
bromobenzene;iridium;pyridine has a molecular weight of 427.32 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;iridium;pyridine is sourced from PubChem (CID 87645537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).