3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid

C8H6F6O2 — CID 87645675

IUPAC3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid
SMILESCC(=CC1C(F)(F)C(F)(F)C1(F)F)C(=O)O
InChIInChI=1S/C8H6F6O2/c1-3(5(15)16)2-4-6(9,10)8(13,14)7(4,11)12/h2,4H,1H3,(H,15,16)
InChIKeyARORSOAEOSXLDJ-UHFFFAOYSA-N
MW248.12 g/mol
LogP2.55
Rot. Bonds2

About 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid

3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid (PubChem CID 87645675) has the molecular formula C8H6F6O2 and a molecular weight of 248.12 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid.

Molecular Properties

Compound Name3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid
PubChem CID87645675
Molecular FormulaC8H6F6O2
Molecular Weight248.12 g/mol
Exact Mass248.03
IUPAC Name3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid
SMILESCC(=CC1C(F)(F)C(F)(F)C1(F)F)C(=O)O
InChIInChI=1S/C8H6F6O2/c1-3(5(15)16)2-4-6(9,10)8(13,14)7(4,11)12/h2,4H,1H3,(H,15,16)
InChIKeyARORSOAEOSXLDJ-UHFFFAOYSA-N
XLogP2.55
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.12
LogP ≤ 52.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid?
The IUPAC name of 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid (CID 87645675) is 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid.
What is the SMILES notation for 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid?
The canonical SMILES for 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid is CC(=CC1C(F)(F)C(F)(F)C1(F)F)C(=O)O.
What is the InChIKey of 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid?
The InChIKey is ARORSOAEOSXLDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F6O2/c1-3(5(15)16)2-4-6(9,10)8(13,14)7(4,11)12/h2,4H,1H3,(H,15,16).
What are the key properties of 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid?
3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid has a molecular weight of 248.12 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid is sourced from PubChem (CID 87645675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).