C8H6F6O2 — CID 87645675
3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid (PubChem CID 87645675) has the molecular formula C8H6F6O2 and a molecular weight of 248.12 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid.
| Compound Name | 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 87645675 |
| Molecular Formula | C8H6F6O2 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 3-(2,2,3,3,4,4-hexafluorocyclobutyl)-2-methylprop-2-enoic acid |
| SMILES | CC(=CC1C(F)(F)C(F)(F)C1(F)F)C(=O)O |
| InChI | InChI=1S/C8H6F6O2/c1-3(5(15)16)2-4-6(9,10)8(13,14)7(4,11)12/h2,4H,1H3,(H,15,16) |
| InChIKey | ARORSOAEOSXLDJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|