2-fluoroethyl(2-hydroxyethyl)carbamic acid

C5H10FNO3 — CID 87645973

IUPAC2-fluoroethyl(2-hydroxyethyl)carbamic acid
SMILESO=C(O)N(CCO)CCF
InChIInChI=1S/C5H10FNO3/c6-1-2-7(3-4-8)5(9)10/h8H,1-4H2,(H,9,10)
InChIKeyNLYNBLARISGUIT-UHFFFAOYSA-N
MW151.14 g/mol
LogP-0.07
Rot. Bonds4

About 2-fluoroethyl(2-hydroxyethyl)carbamic acid

2-fluoroethyl(2-hydroxyethyl)carbamic acid (PubChem CID 87645973) has the molecular formula C5H10FNO3 and a molecular weight of 151.14 g/mol. Its IUPAC name is 2-fluoroethyl(2-hydroxyethyl)carbamic acid.

Molecular Properties

Compound Name2-fluoroethyl(2-hydroxyethyl)carbamic acid
PubChem CID87645973
Molecular FormulaC5H10FNO3
Molecular Weight151.14 g/mol
Exact Mass151.06
IUPAC Name2-fluoroethyl(2-hydroxyethyl)carbamic acid
SMILESO=C(O)N(CCO)CCF
InChIInChI=1S/C5H10FNO3/c6-1-2-7(3-4-8)5(9)10/h8H,1-4H2,(H,9,10)
InChIKeyNLYNBLARISGUIT-UHFFFAOYSA-N
XLogP-0.07
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.14
LogP ≤ 5-0.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-fluoroethyl(2-hydroxyethyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoroethyl(2-hydroxyethyl)carbamic acid?
The IUPAC name of 2-fluoroethyl(2-hydroxyethyl)carbamic acid (CID 87645973) is 2-fluoroethyl(2-hydroxyethyl)carbamic acid.
What is the SMILES notation for 2-fluoroethyl(2-hydroxyethyl)carbamic acid?
The canonical SMILES for 2-fluoroethyl(2-hydroxyethyl)carbamic acid is O=C(O)N(CCO)CCF.
What is the InChIKey of 2-fluoroethyl(2-hydroxyethyl)carbamic acid?
The InChIKey is NLYNBLARISGUIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FNO3/c6-1-2-7(3-4-8)5(9)10/h8H,1-4H2,(H,9,10).
What are the key properties of 2-fluoroethyl(2-hydroxyethyl)carbamic acid?
2-fluoroethyl(2-hydroxyethyl)carbamic acid has a molecular weight of 151.14 g/mol, XLogP of -0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl(2-hydroxyethyl)carbamic acid is sourced from PubChem (CID 87645973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).