About ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate
ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate (PubChem CID 87646091) has the molecular formula C7H9NO3S
and a molecular weight of 187.22 g/mol. Its IUPAC name is ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate |
| PubChem CID | 87646091 |
| Molecular Formula | C7H9NO3S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate |
| SMILES | CCOC(=O)N1C=CSC1C=O |
| InChI | InChI=1S/C7H9NO3S/c1-2-11-7(10)8-3-4-12-6(8)5-9/h3-6H,2H2,1H3 |
| InChIKey | AXPNJYWWBKDWKH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate?
The IUPAC name of ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate (CID 87646091) is ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate.
What is the SMILES notation for ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate?
The canonical SMILES for ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate is CCOC(=O)N1C=CSC1C=O.
What is the InChIKey of ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate?
The InChIKey is AXPNJYWWBKDWKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S/c1-2-11-7(10)8-3-4-12-6(8)5-9/h3-6H,2H2,1H3.
What are the key properties of ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate?
ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate has a molecular weight of 187.22 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-formyl-2H-1,3-thiazole-3-carboxylate is sourced from PubChem (CID 87646091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).