About 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine
1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine (PubChem CID 87646132) has the molecular formula C12H18F5N3S
and a molecular weight of 331.35 g/mol. Its IUPAC name is 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine.
Molecular Properties
| Compound Name | 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine |
| PubChem CID | 87646132 |
| Molecular Formula | C12H18F5N3S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine |
| SMILES | [H]/N=C(\N)N(CCCCC)c1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C12H18F5N3S/c1-2-3-4-9-20(12(18)19)10-5-7-11(8-6-10)21(13,14,15,16)17/h5-8H,2-4,9H2,1H3,(H3,18,19) |
| InChIKey | IVTOPSUCISFYMN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine?
The IUPAC name of 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine (CID 87646132) is 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine.
What is the SMILES notation for 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine?
The canonical SMILES for 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine is [H]/N=C(\N)N(CCCCC)c1ccc(S(F)(F)(F)(F)F)cc1.
What is the InChIKey of 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine?
The InChIKey is IVTOPSUCISFYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F5N3S/c1-2-3-4-9-20(12(18)19)10-5-7-11(8-6-10)21(13,14,15,16)17/h5-8H,2-4,9H2,1H3,(H3,18,19).
What are the key properties of 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine?
1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine has a molecular weight of 331.35 g/mol, XLogP of 5.23, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1-pentylguanidine is sourced from PubChem (CID 87646132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).