C24H23FN5O2+ — CID 87647747
(2R)-1-(4-ethynylphenyl)-2-[2-fluoro-4-(5-methylpyrazol-1-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide (PubChem CID 87647747) has the molecular formula C24H23FN5O2+ and a molecular weight of 432.48 g/mol. Its IUPAC name is (2R)-1-(4-ethynylphenyl)-2-[2-fluoro-4-(5-methylpyrazol-1-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide.
| Compound Name | (2R)-1-(4-ethynylphenyl)-2-[2-fluoro-4-(5-methylpyrazol-1-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87647747 |
| Molecular Formula | C24H23FN5O2+ |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (2R)-1-(4-ethynylphenyl)-2-[2-fluoro-4-(5-methylpyrazol-1-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide |
| SMILES | C#Cc1ccc([N+]2(C(N)=O)CCC[C@]2(C(N)=O)c2ccc(-n3nccc3C)cc2F)cc1 |
| InChI | InChI=1S/C24H22FN5O2/c1-3-17-5-8-19(9-6-17)30(23(27)32)14-4-12-24(30,22(26)31)20-10-7-18(15-21(20)25)29-16(2)11-13-28-29/h1,5-11,13,15H,4,12,14H2,2H3,(H3-,26,27,31,32)/p+1/t24-,30?/m1/s1 |
| InChIKey | IMBARVMAKVKSDB-DDAUYOFQSA-O |
| XLogP | 2.86 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|