About formyl 3-oxo-2-phenoxybutanoate
formyl 3-oxo-2-phenoxybutanoate (PubChem CID 87647967) has the molecular formula C11H10O5
and a molecular weight of 222.20 g/mol. Its IUPAC name is formyl 3-oxo-2-phenoxybutanoate.
Molecular Properties
| Compound Name | formyl 3-oxo-2-phenoxybutanoate |
| PubChem CID | 87647967 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | formyl 3-oxo-2-phenoxybutanoate |
| SMILES | CC(=O)C(Oc1ccccc1)C(=O)OC=O |
| InChI | InChI=1S/C11H10O5/c1-8(13)10(11(14)15-7-12)16-9-5-3-2-4-6-9/h2-7,10H,1H3 |
| InChIKey | CRGCFBJOMXJCBP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze formyl 3-oxo-2-phenoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl 3-oxo-2-phenoxybutanoate?
The IUPAC name of formyl 3-oxo-2-phenoxybutanoate (CID 87647967) is formyl 3-oxo-2-phenoxybutanoate.
What is the SMILES notation for formyl 3-oxo-2-phenoxybutanoate?
The canonical SMILES for formyl 3-oxo-2-phenoxybutanoate is CC(=O)C(Oc1ccccc1)C(=O)OC=O.
What is the InChIKey of formyl 3-oxo-2-phenoxybutanoate?
The InChIKey is CRGCFBJOMXJCBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O5/c1-8(13)10(11(14)15-7-12)16-9-5-3-2-4-6-9/h2-7,10H,1H3.
What are the key properties of formyl 3-oxo-2-phenoxybutanoate?
formyl 3-oxo-2-phenoxybutanoate has a molecular weight of 222.20 g/mol, XLogP of 0.72, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formyl 3-oxo-2-phenoxybutanoate is sourced from PubChem (CID 87647967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).