C27H36ClN3O5 — CID 87648243
(2R)-2-[(1S,3R,4S)-3-amino-4-hydroxycyclopentyl]-2-[(1S)-1-(3-chloro-2-pyridin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde (PubChem CID 87648243) has the molecular formula C27H36ClN3O5 and a molecular weight of 518.05 g/mol. Its IUPAC name is (2R)-2-[(1S,3R,4S)-3-amino-4-hydroxycyclopentyl]-2-[(1S)-1-(3-chloro-2-pyridin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde.
| Compound Name | (2R)-2-[(1S,3R,4S)-3-amino-4-hydroxycyclopentyl]-2-[(1S)-1-(3-chloro-2-pyridin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 87648243 |
| Molecular Formula | C27H36ClN3O5 |
| Molecular Weight | 518.05 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | (2R)-2-[(1S,3R,4S)-3-amino-4-hydroxycyclopentyl]-2-[(1S)-1-(3-chloro-2-pyridin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde |
| SMILES | COCCCC[C@](O)(c1cccc(Cl)c1-c1cccnc1)[C@@]1([C@H]2C[C@@H](N)[C@@H](O)C2)CN(C=O)CCO1 |
| InChI | InChI=1S/C27H36ClN3O5/c1-35-12-3-2-9-26(34,21-7-4-8-22(28)25(21)19-6-5-10-30-16-19)27(17-31(18-32)11-13-36-27)20-14-23(29)24(33)15-20/h4-8,10,16,18,20,23-24,33-34H,2-3,9,11-15,17,29H2,1H3/t20-,23+,24-,26-,27-/m0/s1 |
| InChIKey | FABOLMHJQPUUAG-ABCFHRTJSA-N |
| XLogP | 2.73 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.05 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|