C26H25N4O4+ — CID 87648274
(2R,4R)-1-(4-ethynylphenyl)-4-methoxy-2-[4-(2-oxo-1-pyridinyl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide (PubChem CID 87648274) has the molecular formula C26H25N4O4+ and a molecular weight of 457.51 g/mol. Its IUPAC name is (2R,4R)-1-(4-ethynylphenyl)-4-methoxy-2-[4-(2-oxo-1-pyridinyl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide.
| Compound Name | (2R,4R)-1-(4-ethynylphenyl)-4-methoxy-2-[4-(2-oxo-1-pyridinyl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87648274 |
| Molecular Formula | C26H25N4O4+ |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (2R,4R)-1-(4-ethynylphenyl)-4-methoxy-2-[4-(2-oxo-1-pyridinyl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide |
| SMILES | C#Cc1ccc([N+]2(C(N)=O)C[C@H](OC)C[C@]2(C(N)=O)c2ccc(-n3ccccc3=O)cc2)cc1 |
| InChI | InChI=1S/C26H24N4O4/c1-3-18-7-13-21(14-8-18)30(25(28)33)17-22(34-2)16-26(30,24(27)32)19-9-11-20(12-10-19)29-15-5-4-6-23(29)31/h1,4-15,22H,16-17H2,2H3,(H3-,27,28,32,33)/p+1/t22-,26-,30?/m1/s1 |
| InChIKey | WIHAZZDTFIHZCA-VBOLWYJRSA-O |
| XLogP | 2.00 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|